C21H23ClN6O — CID 139513445
1-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]piperidine-4-carbaldehyde (PubChem CID 139513445) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 1-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 139513445 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[(7R)-6-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-7-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]piperidine-4-carbaldehyde |
| SMILES | C[C@@H]1Cc2ncnc(N3CCC(C=O)CC3)c2CN1c1cc(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C21H23ClN6O/c1-13-8-17-16(21(25-12-24-17)27-6-3-14(11-29)4-7-27)10-28(13)18-9-19(22)26-20-15(18)2-5-23-20/h2,5,9,11-14H,3-4,6-8,10H2,1H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | FOHMWPMTMGJDKB-CYBMUJFWSA-N |
| XLogP | 3.37 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|