C9H5N3O3 — CID 139513476
1,3,5-triethynyl-6-hydroxy-1,3,5-triazinane-2,4-dione (PubChem CID 139513476) has the molecular formula C9H5N3O3 and a molecular weight of 203.16 g/mol. Its IUPAC name is 1,3,5-triethynyl-6-hydroxy-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-triethynyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 139513476 |
| Molecular Formula | C9H5N3O3 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1,3,5-triethynyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
| SMILES | C#CN1C(=O)N(C#C)C(O)N(C#C)C1=O |
| InChI | InChI=1S/C9H5N3O3/c1-4-10-7(13)11(5-2)9(15)12(6-3)8(10)14/h1-3,7,13H |
| InChIKey | UJZBQBJCEYAPKP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|