C28H22Cl2N2O7 — CID 139513534
5,21-dichloro-23-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl]-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 139513534) has the molecular formula C28H22Cl2N2O7 and a molecular weight of 569.40 g/mol. Its IUPAC name is 5,21-dichloro-23-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl]-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 5,21-dichloro-23-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl]-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 139513534 |
| Molecular Formula | C28H22Cl2N2O7 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 5,21-dichloro-23-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-3-yl]-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COC1C(CO)OCC(O)(C2c3c(Cl)cccc3-c3c4c(c5c([nH]c6c(Cl)cccc65)c32)C(=O)NC4=O)C1O |
| InChI | InChI=1S/C28H22Cl2N2O7/c1-38-24-14(8-33)39-9-28(37,25(24)34)21-15-10(4-2-6-12(15)29)16-18-19(27(36)32-26(18)35)17-11-5-3-7-13(30)22(11)31-23(17)20(16)21/h2-7,14,21,24-25,31,33-34,37H,8-9H2,1H3,(H,32,35,36) |
| InChIKey | CIFJJXNEWFNVKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|