C11H15NO2S — CID 139513589
(3R,4S,5S)-5-phenylsulfanylpiperidine-3,4-diol (PubChem CID 139513589) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (3R,4S,5S)-5-phenylsulfanylpiperidine-3,4-diol.
| Compound Name | (3R,4S,5S)-5-phenylsulfanylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 139513589 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (3R,4S,5S)-5-phenylsulfanylpiperidine-3,4-diol |
| SMILES | O[C@H]1[C@H](O)CNC[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C11H15NO2S/c13-9-6-12-7-10(11(9)14)15-8-4-2-1-3-5-8/h1-5,9-14H,6-7H2/t9-,10+,11+/m1/s1 |
| InChIKey | FFJIKUGUIHMTKK-VWYCJHECSA-N |
| XLogP | 0.47 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |