C21H26N4O — CID 139513724
(6-methyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl)-(5-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone (PubChem CID 139513724) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is (6-methyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl)-(5-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone.
| Compound Name | (6-methyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl)-(5-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 139513724 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (6-methyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl)-(5-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone |
| SMILES | CN1CCc2c(C(=O)N3CC4CC(c5ccccc5)CC4C3)n[nH]c2C1 |
| InChI | InChI=1S/C21H26N4O/c1-24-8-7-18-19(13-24)22-23-20(18)21(26)25-11-16-9-15(10-17(16)12-25)14-5-3-2-4-6-14/h2-6,15-17H,7-13H2,1H3,(H,22,23) |
| InChIKey | HIJWHJVQPSLCBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |