About 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine
1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine (PubChem CID 139514338) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine.
Molecular Properties
| Compound Name | 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine |
| PubChem CID | 139514338 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine |
| SMILES | C=CC(=C)CCC(C(=C)C)N1CCCCC1 |
| InChI | InChI=1S/C15H25N/c1-5-14(4)9-10-15(13(2)3)16-11-7-6-8-12-16/h5,15H,1-2,4,6-12H2,3H3 |
| InChIKey | TZPZNBXVLSTJFT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine?
The IUPAC name of 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine (CID 139514338) is 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine.
What is the SMILES notation for 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine?
The canonical SMILES for 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine is C=CC(=C)CCC(C(=C)C)N1CCCCC1.
What is the InChIKey of 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine?
The InChIKey is TZPZNBXVLSTJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-5-14(4)9-10-15(13(2)3)16-11-7-6-8-12-16/h5,15H,1-2,4,6-12H2,3H3.
What are the key properties of 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine?
1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine has a molecular weight of 219.37 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-6-methylideneocta-1,7-dien-3-yl)piperidine is sourced from PubChem (CID 139514338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).