About N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine
N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine (PubChem CID 139514343) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine.
Molecular Properties
| Compound Name | N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine |
| PubChem CID | 139514343 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine |
| SMILES | C=CC(=C)CCC(N=C)C(=C)C |
| InChI | InChI=1S/C11H17N/c1-6-10(4)7-8-11(12-5)9(2)3/h6,11H,1-2,4-5,7-8H2,3H3 |
| InChIKey | WIWPUVXZNNRGSX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine?
The IUPAC name of N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine (CID 139514343) is N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine.
What is the SMILES notation for N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine?
The canonical SMILES for N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine is C=CC(=C)CCC(N=C)C(=C)C.
What is the InChIKey of N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine?
The InChIKey is WIWPUVXZNNRGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-6-10(4)7-8-11(12-5)9(2)3/h6,11H,1-2,4-5,7-8H2,3H3.
What are the key properties of N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine?
N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine has a molecular weight of 163.26 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-6-methylideneocta-1,7-dien-3-yl)methanimine is sourced from PubChem (CID 139514343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).