C17H19F2N3O — CID 139514868
2-amino-5-(3,5-difluorophenyl)-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-4H-imidazol-4-ol (PubChem CID 139514868) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-amino-5-(3,5-difluorophenyl)-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-4H-imidazol-4-ol.
| Compound Name | 2-amino-5-(3,5-difluorophenyl)-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-4H-imidazol-4-ol |
|---|---|
| PubChem CID | 139514868 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-amino-5-(3,5-difluorophenyl)-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-4H-imidazol-4-ol |
| SMILES | C=C/C=C\C=C(/C)C1(c2cc(F)cc(F)c2)N=C(N)N(C)C1O |
| InChI | InChI=1S/C17H19F2N3O/c1-4-5-6-7-11(2)17(15(23)22(3)16(20)21-17)12-8-13(18)10-14(19)9-12/h4-10,15,23H,1H2,2-3H3,(H2,20,21)/b6-5-,11-7+ |
| InChIKey | XWSJMUJEZQFABW-GNLLZQBYSA-N |
| XLogP | 2.43 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|