C14H13F5N3OP3 — CID 139514888
2-[4-(3,4-difluorophenyl)phenoxy]-2,4,4-trifluoro-6,6-dimethyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 139514888) has the molecular formula C14H13F5N3OP3 and a molecular weight of 427.19 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)phenoxy]-2,4,4-trifluoro-6,6-dimethyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2-[4-(3,4-difluorophenyl)phenoxy]-2,4,4-trifluoro-6,6-dimethyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 139514888 |
| Molecular Formula | C14H13F5N3OP3 |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)phenoxy]-2,4,4-trifluoro-6,6-dimethyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | CP1(C)=NP(F)(F)=NP(F)(Oc2ccc(-c3ccc(F)c(F)c3)cc2)=N1 |
| InChI | InChI=1S/C14H13F5N3OP3/c1-24(2)20-25(17,18)22-26(19,21-24)23-12-6-3-10(4-7-12)11-5-8-13(15)14(16)9-11/h3-9H,1-2H3 |
| InChIKey | WXDNWMRLVVXQRS-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|