C26H25Cl2N9O2 — CID 139515165
6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-[1-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-oxo-3-phenylpropan-2-yl]pyrimidin-4-one (PubChem CID 139515165) has the molecular formula C26H25Cl2N9O2 and a molecular weight of 566.45 g/mol. Its IUPAC name is 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-[1-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-oxo-3-phenylpropan-2-yl]pyrimidin-4-one.
| Compound Name | 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-[1-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-oxo-3-phenylpropan-2-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 139515165 |
| Molecular Formula | C26H25Cl2N9O2 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-[1-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)-1-oxo-3-phenylpropan-2-yl]pyrimidin-4-one |
| SMILES | N/C(Cl)=C\N(N)c1ccc(Cl)cc1-c1cc(=O)n(C(Cc2ccccc2)C(=O)N2CCn3ncnc3C2)cn1 |
| InChI | InChI=1S/C26H25Cl2N9O2/c27-18-6-7-21(36(30)13-23(28)29)19(11-18)20-12-25(38)35(16-32-20)22(10-17-4-2-1-3-5-17)26(39)34-8-9-37-24(14-34)31-15-33-37/h1-7,11-13,15-16,22H,8-10,14,29-30H2/b23-13- |
| InChIKey | PKFHJOIBLKQBCO-QRVIBDJDSA-N |
| XLogP | 2.66 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|