About 5-methyl-5,6-dihydronaphthalen-2-amine
5-methyl-5,6-dihydronaphthalen-2-amine (PubChem CID 139515733) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-methyl-5,6-dihydronaphthalen-2-amine.
Molecular Properties
| Compound Name | 5-methyl-5,6-dihydronaphthalen-2-amine |
| PubChem CID | 139515733 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 5-methyl-5,6-dihydronaphthalen-2-amine |
| SMILES | CC1CC=Cc2cc(N)ccc21 |
| InChI | InChI=1S/C11H13N/c1-8-3-2-4-9-7-10(12)5-6-11(8)9/h2,4-8H,3,12H2,1H3 |
| InChIKey | BJVWVMACCCQKGN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5,6-dihydronaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5,6-dihydronaphthalen-2-amine?
The IUPAC name of 5-methyl-5,6-dihydronaphthalen-2-amine (CID 139515733) is 5-methyl-5,6-dihydronaphthalen-2-amine.
What is the SMILES notation for 5-methyl-5,6-dihydronaphthalen-2-amine?
The canonical SMILES for 5-methyl-5,6-dihydronaphthalen-2-amine is CC1CC=Cc2cc(N)ccc21.
What is the InChIKey of 5-methyl-5,6-dihydronaphthalen-2-amine?
The InChIKey is BJVWVMACCCQKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-3-2-4-9-7-10(12)5-6-11(8)9/h2,4-8H,3,12H2,1H3.
What are the key properties of 5-methyl-5,6-dihydronaphthalen-2-amine?
5-methyl-5,6-dihydronaphthalen-2-amine has a molecular weight of 159.23 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5,6-dihydronaphthalen-2-amine is sourced from PubChem (CID 139515733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).