C25H37N5 — CID 139516116
(1E,3Z,7Z)-7-(1-cyclopentyl-5-ethenyl-2-prop-1-en-2-yliminopyrrol-3-ylidene)-2-piperazin-1-ylhepta-1,3-dien-1-amine (PubChem CID 139516116) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is (1E,3Z,7Z)-7-(1-cyclopentyl-5-ethenyl-2-prop-1-en-2-yliminopyrrol-3-ylidene)-2-piperazin-1-ylhepta-1,3-dien-1-amine.
| Compound Name | (1E,3Z,7Z)-7-(1-cyclopentyl-5-ethenyl-2-prop-1-en-2-yliminopyrrol-3-ylidene)-2-piperazin-1-ylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 139516116 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | (1E,3Z,7Z)-7-(1-cyclopentyl-5-ethenyl-2-prop-1-en-2-yliminopyrrol-3-ylidene)-2-piperazin-1-ylhepta-1,3-dien-1-amine |
| SMILES | C=CC1=CC(=C/CC/C=C\C(=C/N)N2CCNCC2)/C(=N/C(=C)C)N1C1CCCC1 |
| InChI | InChI=1S/C25H37N5/c1-4-22-18-21(25(28-20(2)3)30(22)23-11-8-9-12-23)10-6-5-7-13-24(19-26)29-16-14-27-15-17-29/h4,7,10,13,18-19,23,27H,1-2,5-6,8-9,11-12,14-17,26H2,3H3/b13-7-,21-10-,24-19+,28-25- |
| InChIKey | HAWIAMBCIZOFBN-ZFONXSIWSA-N |
| XLogP | 4.21 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|