C14H26N2 — CID 139516197
N'-[(2Z,4Z)-4,6-dimethylhepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 139516197) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N'-[(2Z,4Z)-4,6-dimethylhepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(2Z,4Z)-4,6-dimethylhepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139516197 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N'-[(2Z,4Z)-4,6-dimethylhepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C(C)/C=C(C)\C(=C\C)N(C)CCN(C)C |
| InChI | InChI=1S/C14H26N2/c1-8-14(13(4)11-12(2)3)16(7)10-9-15(5)6/h8,11H,2,9-10H2,1,3-7H3/b13-11-,14-8- |
| InChIKey | ZZBHOQVUGSDDPR-ZLQYQGLLSA-N |
| XLogP | 2.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|