C8H11N3O — CID 139516327
2-ethyl-1,5,6,7-tetrahydroimidazo[4,5-c]pyridin-4-one (PubChem CID 139516327) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-ethyl-1,5,6,7-tetrahydroimidazo[4,5-c]pyridin-4-one.
| Compound Name | 2-ethyl-1,5,6,7-tetrahydroimidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 139516327 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-ethyl-1,5,6,7-tetrahydroimidazo[4,5-c]pyridin-4-one |
| SMILES | CCc1nc2c([nH]1)CCNC2=O |
| InChI | InChI=1S/C8H11N3O/c1-2-6-10-5-3-4-9-8(12)7(5)11-6/h2-4H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | TVPFPCQKIPPDLT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |