C13H20N2O5S — CID 139516819
2-[2-[2-(3,5-dimethyl-2,6-dioxopiperidin-1-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 139516819) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[2-[2-(3,5-dimethyl-2,6-dioxopiperidin-1-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[2-(3,5-dimethyl-2,6-dioxopiperidin-1-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 139516819 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[2-[2-(3,5-dimethyl-2,6-dioxopiperidin-1-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CC1CC(C)C(=O)N(CCNC(=O)CSCC(=O)O)C1=O |
| InChI | InChI=1S/C13H20N2O5S/c1-8-5-9(2)13(20)15(12(8)19)4-3-14-10(16)6-21-7-11(17)18/h8-9H,3-7H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | DXALVQQQNFDTDC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|