About N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide
N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide (PubChem CID 139517046) has the molecular formula C15H23N3O4S
and a molecular weight of 341.43 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide.
Molecular Properties
| Compound Name | N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide |
| PubChem CID | 139517046 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide |
| SMILES | O=C(CCN1C(=O)CSC1=O)NCCCC(=O)NCC1CCC1 |
| InChI | InChI=1S/C15H23N3O4S/c19-12(17-9-11-3-1-4-11)5-2-7-16-13(20)6-8-18-14(21)10-23-15(18)22/h11H,1-10H2,(H,16,20)(H,17,19) |
| InChIKey | IRDSKQGXSVVORV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide?
The IUPAC name of N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide (CID 139517046) is N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide.
What is the SMILES notation for N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide?
The canonical SMILES for N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide is O=C(CCN1C(=O)CSC1=O)NCCCC(=O)NCC1CCC1.
What is the InChIKey of N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide?
The InChIKey is IRDSKQGXSVVORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4S/c19-12(17-9-11-3-1-4-11)5-2-7-16-13(20)6-8-18-14(21)10-23-15(18)22/h11H,1-10H2,(H,16,20)(H,17,19).
What are the key properties of N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide?
N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide has a molecular weight of 341.43 g/mol, XLogP of 0.88, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclobutylmethyl)-4-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoylamino]butanamide is sourced from PubChem (CID 139517046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).