C15H25N3O4S — CID 139517089
N-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N'-(3-methylpentan-2-yl)propanediamide (PubChem CID 139517089) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N'-(3-methylpentan-2-yl)propanediamide.
| Compound Name | N-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N'-(3-methylpentan-2-yl)propanediamide |
|---|---|
| PubChem CID | 139517089 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N'-(3-methylpentan-2-yl)propanediamide |
| SMILES | CCC(C)C(C)NC(=O)CC(=O)NCCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C15H25N3O4S/c1-4-10(2)11(3)17-13(20)8-12(19)16-6-5-7-18-14(21)9-23-15(18)22/h10-11H,4-9H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | JPVUQIHYQJCFOH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|