C22H31ClN8O6S — CID 139517410
(2R,3S)-N'-[(E)-2-chloroprop-1-enyl]-3-[[4-(4,6-dimethoxypyrimidin-5-yl)-5-[3-(hydroxymethyl)cyclobutyl]-1,2,4-triazol-3-yl]sulfamoyl]-2-methoxy-N-methylidenebutanimidamide (PubChem CID 139517410) has the molecular formula C22H31ClN8O6S and a molecular weight of 571.06 g/mol. Its IUPAC name is (2R,3S)-N'-[(E)-2-chloroprop-1-enyl]-3-[[4-(4,6-dimethoxypyrimidin-5-yl)-5-[3-(hydroxymethyl)cyclobutyl]-1,2,4-triazol-3-yl]sulfamoyl]-2-methoxy-N-methylidenebutanimidamide.
| Compound Name | (2R,3S)-N'-[(E)-2-chloroprop-1-enyl]-3-[[4-(4,6-dimethoxypyrimidin-5-yl)-5-[3-(hydroxymethyl)cyclobutyl]-1,2,4-triazol-3-yl]sulfamoyl]-2-methoxy-N-methylidenebutanimidamide |
|---|---|
| PubChem CID | 139517410 |
| Molecular Formula | C22H31ClN8O6S |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (2R,3S)-N'-[(E)-2-chloroprop-1-enyl]-3-[[4-(4,6-dimethoxypyrimidin-5-yl)-5-[3-(hydroxymethyl)cyclobutyl]-1,2,4-triazol-3-yl]sulfamoyl]-2-methoxy-N-methylidenebutanimidamide |
| SMILES | C=N/C(=N\C=C(/C)Cl)[C@@H](OC)[C@H](C)S(=O)(=O)Nc1nnc(C2CC(CO)C2)n1-c1c(OC)ncnc1OC |
| InChI | InChI=1S/C22H31ClN8O6S/c1-12(23)9-25-18(24-3)17(35-4)13(2)38(33,34)30-22-29-28-19(15-7-14(8-15)10-32)31(22)16-20(36-5)26-11-27-21(16)37-6/h9,11,13-15,17,32H,3,7-8,10H2,1-2,4-6H3,(H,29,30)/b12-9+,25-18-/t13-,14?,15?,17-/m0/s1 |
| InChIKey | XQPBMSUCNHRTIE-ATVFAMSOSA-N |
| XLogP | 1.90 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|