C27H27N5 — CID 139518693
3-N,6-N-bis(4-aminophenyl)-3-N,6-N,9-trimethylcarbazole-3,6-diamine (PubChem CID 139518693) has the molecular formula C27H27N5 and a molecular weight of 421.55 g/mol. Its IUPAC name is 3-N,6-N-bis(4-aminophenyl)-3-N,6-N,9-trimethylcarbazole-3,6-diamine.
| Compound Name | 3-N,6-N-bis(4-aminophenyl)-3-N,6-N,9-trimethylcarbazole-3,6-diamine |
|---|---|
| PubChem CID | 139518693 |
| Molecular Formula | C27H27N5 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 3-N,6-N-bis(4-aminophenyl)-3-N,6-N,9-trimethylcarbazole-3,6-diamine |
| SMILES | CN(c1ccc(N)cc1)c1ccc2c(c1)c1cc(N(C)c3ccc(N)cc3)ccc1n2C |
| InChI | InChI=1S/C27H27N5/c1-30(20-8-4-18(28)5-9-20)22-12-14-26-24(16-22)25-17-23(13-15-27(25)32(26)3)31(2)21-10-6-19(29)7-11-21/h4-17H,28-29H2,1-3H3 |
| InChIKey | OHJKQONUYZXKJT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|