C35H41ClO10 — CID 139518833
methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoate (PubChem CID 139518833) has the molecular formula C35H41ClO10 and a molecular weight of 657.16 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139518833 |
| Molecular Formula | C35H41ClO10 |
| Molecular Weight | 657.16 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C(OC)=C2C3CC4CC(C3)CC2C4)c(Cl)c1OCc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C35H41ClO10/c1-42-27(38)10-6-21-5-9-25(34(43-2)28-22-12-19-11-20(14-22)15-23(28)13-19)29(36)33(21)44-17-18-3-7-24(8-4-18)45-35-32(41)31(40)30(39)26(16-37)46-35/h3-10,19-20,22-23,26,30-32,35,37,39-41H,11-17H2,1-2H3/b10-6+,34-28- |
| InChIKey | YIXABCPPOZLDTP-IMNDSVRWSA-N |
| XLogP | 4.10 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|