About 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol
3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol (PubChem CID 139518922) has the molecular formula C25H36O4
and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol.
Molecular Properties
| Compound Name | 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol |
| PubChem CID | 139518922 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol |
| SMILES | CCC[C@H](C)CCc1ccc(O)cc1C1(OC)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C25H36O4/c1-4-5-16(2)6-7-19-8-9-22(26)15-23(19)25(27-3)24(28-29-25)20-11-17-10-18(13-20)14-21(24)12-17/h8-9,15-18,20-21,26H,4-7,10-14H2,1-3H3/t16-,17?,18?,20?,21?,24?,25?/m0/s1 |
| InChIKey | JHTCVYBEVQMYGS-HZQHRJRPSA-N |
| XLogP | 5.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol?
The IUPAC name of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol (CID 139518922) is 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol.
What is the SMILES notation for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol?
The canonical SMILES for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol is CCC[C@H](C)CCc1ccc(O)cc1C1(OC)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol?
The InChIKey is JHTCVYBEVQMYGS-HZQHRJRPSA-N. The full InChI is InChI=1S/C25H36O4/c1-4-5-16(2)6-7-19-8-9-22(26)15-23(19)25(27-3)24(28-29-25)20-11-17-10-18(13-20)14-21(24)12-17/h8-9,15-18,20-21,26H,4-7,10-14H2,1-3H3/t16-,17?,18?,20?,21?,24?,25?/m0/s1.
What are the key properties of 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol?
3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol has a molecular weight of 400.56 g/mol, XLogP of 5.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-4-[(3S)-3-methylhexyl]phenol is sourced from PubChem (CID 139518922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).