C19H17F4N3O4 — CID 139519000
(2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 139519000) has the molecular formula C19H17F4N3O4 and a molecular weight of 427.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139519000 |
| Molecular Formula | C19H17F4N3O4 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(F)c(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H17F4N3O4/c1-8-10-4-5-26(17(10)25-7-24-8)18-15(29)14(28)16(30-18)13(27)9-2-3-12(20)11(6-9)19(21,22)23/h2-7,13-16,18,27-29H,1H3/t13?,14-,15+,16+,18+/m0/s1 |
| InChIKey | DFIRQALITBYWLG-KAFHFREQSA-N |
| XLogP | 2.25 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |