C26H30F2O — CID 139519318
(3E,5E,7E,9Z)-6,7-bis(ethenyl)-3-[(2E)-2-ethenyl-1,1-difluoro-5-methylhexa-2,4-dienoxy]-10-methyldodeca-1,3,5,7,9,11-hexaene (PubChem CID 139519318) has the molecular formula C26H30F2O and a molecular weight of 396.52 g/mol. Its IUPAC name is (3E,5E,7E,9Z)-6,7-bis(ethenyl)-3-[(2E)-2-ethenyl-1,1-difluoro-5-methylhexa-2,4-dienoxy]-10-methyldodeca-1,3,5,7,9,11-hexaene.
| Compound Name | (3E,5E,7E,9Z)-6,7-bis(ethenyl)-3-[(2E)-2-ethenyl-1,1-difluoro-5-methylhexa-2,4-dienoxy]-10-methyldodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 139519318 |
| Molecular Formula | C26H30F2O |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3E,5E,7E,9Z)-6,7-bis(ethenyl)-3-[(2E)-2-ethenyl-1,1-difluoro-5-methylhexa-2,4-dienoxy]-10-methyldodeca-1,3,5,7,9,11-hexaene |
| SMILES | C=C/C(C)=C\C=C(C=C)\C(C=C)=C\C=C(/C=C)OC(F)(F)/C(C=C)=C/C=C(C)C |
| InChI | InChI=1S/C26H30F2O/c1-9-21(8)15-16-22(10-2)23(11-3)17-19-25(13-5)29-26(27,28)24(12-4)18-14-20(6)7/h9-19H,1-5H2,6-8H3/b21-15-,22-16+,23-17+,24-18+,25-19+ |
| InChIKey | BVBWQQGBXLHNNJ-NPASGJMSSA-N |
| XLogP | 8.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|