C17H30N2 — CID 139519521
(2E,7Z)-N-ethyl-3-methyl-6-methylidene-5-(2-methylpropylideneamino)nona-2,7-dien-4-amine (PubChem CID 139519521) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (2E,7Z)-N-ethyl-3-methyl-6-methylidene-5-(2-methylpropylideneamino)nona-2,7-dien-4-amine.
| Compound Name | (2E,7Z)-N-ethyl-3-methyl-6-methylidene-5-(2-methylpropylideneamino)nona-2,7-dien-4-amine |
|---|---|
| PubChem CID | 139519521 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (2E,7Z)-N-ethyl-3-methyl-6-methylidene-5-(2-methylpropylideneamino)nona-2,7-dien-4-amine |
| SMILES | C=C(/C=C\C)C(/N=C/C(C)C)C(NCC)/C(C)=C/C |
| InChI | InChI=1S/C17H30N2/c1-8-11-15(7)17(19-12-13(4)5)16(18-10-3)14(6)9-2/h8-9,11-13,16-18H,7,10H2,1-6H3/b11-8-,14-9+,19-12+ |
| InChIKey | WGAHJVGVTTYQSC-FBYQXNCXSA-N |
| XLogP | 4.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|