About (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate
(2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate (PubChem CID 139519532) has the molecular formula C17H11F2NO5
and a molecular weight of 347.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
| PubChem CID | 139519532 |
| Molecular Formula | C17H11F2NO5 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc(-c2ccc(F)cc2F)ccc1O |
| InChI | InChI=1S/C17H11F2NO5/c18-10-2-3-11(13(19)8-10)9-1-4-14(21)12(7-9)17(24)25-20-15(22)5-6-16(20)23/h1-4,7-8,21H,5-6H2 |
| InChIKey | DHUMFPGEBBLWOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate (CID 139519532) is (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate is O=C(ON1C(=O)CCC1=O)c1cc(-c2ccc(F)cc2F)ccc1O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate?
The InChIKey is DHUMFPGEBBLWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2NO5/c18-10-2-3-11(13(19)8-10)9-1-4-14(21)12(7-9)17(24)25-20-15(22)5-6-16(20)23/h1-4,7-8,21H,5-6H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate?
(2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate has a molecular weight of 347.27 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 5-(2,4-difluorophenyl)-2-hydroxybenzoate is sourced from PubChem (CID 139519532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).