C17H22N2O2 — CID 139520036
(3E,5E)-3-ethenyl-6-(4-prop-2-enoylpiperazin-1-yl)octa-3,5,7-trien-2-one (PubChem CID 139520036) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-6-(4-prop-2-enoylpiperazin-1-yl)octa-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-3-ethenyl-6-(4-prop-2-enoylpiperazin-1-yl)octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 139520036 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3E,5E)-3-ethenyl-6-(4-prop-2-enoylpiperazin-1-yl)octa-3,5,7-trien-2-one |
| SMILES | C=CC(=O)N1CCN(/C(C=C)=C/C=C(\C=C)C(C)=O)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-5-15(14(4)20)8-9-16(6-2)18-10-12-19(13-11-18)17(21)7-3/h5-9H,1-3,10-13H2,4H3/b15-8+,16-9+ |
| InChIKey | VDRXQARELPYZIL-BVXMOGEKSA-N |
| XLogP | 2.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|