C15H20N2O — CID 139520063
1-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 139520063) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139520063 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-[4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=C/C=C\C(=C/C=C)N1CCN(C(=O)C=C)CC1 |
| InChI | InChI=1S/C15H20N2O/c1-4-7-9-14(8-5-2)16-10-12-17(13-11-16)15(18)6-3/h4-9H,1-3,10-13H2/b9-7-,14-8+ |
| InChIKey | JOPVVPPWEYXZKX-JIAHQVGESA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|