C16H23NO2 — CID 139520080
N-[(3E,5Z)-5-ethenoxy-4-methylocta-3,5,7-trienyl]-N-ethylprop-2-enamide (PubChem CID 139520080) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(3E,5Z)-5-ethenoxy-4-methylocta-3,5,7-trienyl]-N-ethylprop-2-enamide.
| Compound Name | N-[(3E,5Z)-5-ethenoxy-4-methylocta-3,5,7-trienyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 139520080 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(3E,5Z)-5-ethenoxy-4-methylocta-3,5,7-trienyl]-N-ethylprop-2-enamide |
| SMILES | C=C/C=C(OC=C)/C(C)=C/CCN(CC)C(=O)C=C |
| InChI | InChI=1S/C16H23NO2/c1-6-11-15(19-9-4)14(5)12-10-13-17(8-3)16(18)7-2/h6-7,9,11-12H,1-2,4,8,10,13H2,3,5H3/b14-12+,15-11- |
| InChIKey | UUNKHDIOMQWKPA-BASNAROOSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|