About 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one
1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one (PubChem CID 139520082) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one |
| PubChem CID | 139520082 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC=C(C2=CCCO2)C1 |
| InChI | InChI=1S/C12H15NO2/c1-2-12(14)13-7-3-5-10(9-13)11-6-4-8-15-11/h2,5-6H,1,3-4,7-9H2 |
| InChIKey | VAPSVPHPECBMIS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one?
The IUPAC name of 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one (CID 139520082) is 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one?
The canonical SMILES for 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one is C=CC(=O)N1CCC=C(C2=CCCO2)C1.
What is the InChIKey of 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one?
The InChIKey is VAPSVPHPECBMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-12(14)13-7-3-5-10(9-13)11-6-4-8-15-11/h2,5-6H,1,3-4,7-9H2.
What are the key properties of 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one?
1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one has a molecular weight of 205.26 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,3-dihydrofuran-5-yl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 139520082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).