C19H17ClN4O2 — CID 139521462
N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-1-ethyl-6-oxopyridazine-3-carboxamide (PubChem CID 139521462) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-1-ethyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-1-ethyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 139521462 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-2-pyridinyl]-1-ethyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCn1nc(C(=O)Nc2ccc(Cc3cccc(Cl)c3)cn2)ccc1=O |
| InChI | InChI=1S/C19H17ClN4O2/c1-2-24-18(25)9-7-16(23-24)19(26)22-17-8-6-14(12-21-17)10-13-4-3-5-15(20)11-13/h3-9,11-12H,2,10H2,1H3,(H,21,22,26) |
| InChIKey | ZIFLRFHAOHCJGF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |