C12H19F2N — CID 139522061
(3Z,5E,9E)-7,10-difluorododeca-3,5,9-trien-5-amine (PubChem CID 139522061) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is (3Z,5E,9E)-7,10-difluorododeca-3,5,9-trien-5-amine.
| Compound Name | (3Z,5E,9E)-7,10-difluorododeca-3,5,9-trien-5-amine |
|---|---|
| PubChem CID | 139522061 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3Z,5E,9E)-7,10-difluorododeca-3,5,9-trien-5-amine |
| SMILES | CC/C=C\C(N)=C/C(F)C/C=C(/F)CC |
| InChI | InChI=1S/C12H19F2N/c1-3-5-6-12(15)9-11(14)8-7-10(13)4-2/h5-7,9,11H,3-4,8,15H2,1-2H3/b6-5-,10-7+,12-9+ |
| InChIKey | HFQSEHDGHLBJLZ-YKWTYFAOSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|