C11H18N2 — CID 139522229
(3E)-4-(but-3-en-2-ylideneamino)-N,N,3-trimethylbuta-1,3-dien-2-amine (PubChem CID 139522229) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3E)-4-(but-3-en-2-ylideneamino)-N,N,3-trimethylbuta-1,3-dien-2-amine.
| Compound Name | (3E)-4-(but-3-en-2-ylideneamino)-N,N,3-trimethylbuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 139522229 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3E)-4-(but-3-en-2-ylideneamino)-N,N,3-trimethylbuta-1,3-dien-2-amine |
| SMILES | C=C/C(C)=N/C=C(\C)C(=C)N(C)C |
| InChI | InChI=1S/C11H18N2/c1-7-10(3)12-8-9(2)11(4)13(5)6/h7-8H,1,4H2,2-3,5-6H3/b9-8+,12-10+ |
| InChIKey | IHKDZBJXODXDJG-CDKJVOIVSA-N |
| XLogP | 2.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|