C29H53NO9 — CID 139522238
(3R,5R,7S,9R,11R,12S,13R)-4-[4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-7,12-dihydroxy-14-(1-hydroxyethyl)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 139522238) has the molecular formula C29H53NO9 and a molecular weight of 559.74 g/mol. Its IUPAC name is (3R,5R,7S,9R,11R,12S,13R)-4-[4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-7,12-dihydroxy-14-(1-hydroxyethyl)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,5R,7S,9R,11R,12S,13R)-4-[4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-7,12-dihydroxy-14-(1-hydroxyethyl)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 139522238 |
| Molecular Formula | C29H53NO9 |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | (3R,5R,7S,9R,11R,12S,13R)-4-[4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-7,12-dihydroxy-14-(1-hydroxyethyl)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC(O)C1OC(=O)[C@H](C)C(OC2CC(N(C)C)C(O)C(C)O2)[C@H](C)C[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C29H53NO9/c1-14-12-29(8,36)13-15(2)26(38-22-11-21(30(9)10)25(34)20(7)37-22)18(5)28(35)39-27(19(6)31)17(4)24(33)16(3)23(14)32/h14-22,24-27,31,33-34,36H,11-13H2,1-10H3/t14-,15-,16+,17-,18-,19?,20?,21?,22?,24-,25?,26?,27?,29-/m1/s1 |
| InChIKey | ONWXKNKHYHEBSS-XMTOJKGOSA-N |
| XLogP | 1.75 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |