C11H19NO2 — CID 139523180
(E)-4-[(3R,5R)-3,5-dimethylmorpholin-4-yl]pent-3-en-2-one (PubChem CID 139523180) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (E)-4-[(3R,5R)-3,5-dimethylmorpholin-4-yl]pent-3-en-2-one.
| Compound Name | (E)-4-[(3R,5R)-3,5-dimethylmorpholin-4-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 139523180 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (E)-4-[(3R,5R)-3,5-dimethylmorpholin-4-yl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C(\C)N1[C@H](C)COC[C@H]1C |
| InChI | InChI=1S/C11H19NO2/c1-8(5-11(4)13)12-9(2)6-14-7-10(12)3/h5,9-10H,6-7H2,1-4H3/b8-5+/t9-,10-/m1/s1 |
| InChIKey | VCDHQFQCUANYDD-STFJZOTBSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|