C21H23ClFN5O3 — CID 139523363
2-[3-[amino(hydroxy)methyl]indazol-1-yl]-N-[2-[(3-chloro-2-fluorophenyl)methylamino]-2-oxoethyl]-N-ethylacetamide (PubChem CID 139523363) has the molecular formula C21H23ClFN5O3 and a molecular weight of 447.90 g/mol. Its IUPAC name is 2-[3-[amino(hydroxy)methyl]indazol-1-yl]-N-[2-[(3-chloro-2-fluorophenyl)methylamino]-2-oxoethyl]-N-ethylacetamide.
| Compound Name | 2-[3-[amino(hydroxy)methyl]indazol-1-yl]-N-[2-[(3-chloro-2-fluorophenyl)methylamino]-2-oxoethyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 139523363 |
| Molecular Formula | C21H23ClFN5O3 |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[3-[amino(hydroxy)methyl]indazol-1-yl]-N-[2-[(3-chloro-2-fluorophenyl)methylamino]-2-oxoethyl]-N-ethylacetamide |
| SMILES | CCN(CC(=O)NCc1cccc(Cl)c1F)C(=O)Cn1nc(C(N)O)c2ccccc21 |
| InChI | InChI=1S/C21H23ClFN5O3/c1-2-27(11-17(29)25-10-13-6-5-8-15(22)19(13)23)18(30)12-28-16-9-4-3-7-14(16)20(26-28)21(24)31/h3-9,21,31H,2,10-12,24H2,1H3,(H,25,29) |
| InChIKey | XBRMOYREAPMJGF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|