About 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid
4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid (PubChem CID 139523830) has the molecular formula C14H22F2O3S
and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid |
| PubChem CID | 139523830 |
| Molecular Formula | C14H22F2O3S |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)(F)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H22F2O3S/c15-14(16,9-20(17,18)19)2-1-13-6-10-3-11(7-13)5-12(4-10)8-13/h10-12H,1-9H2,(H,17,18,19) |
| InChIKey | VCYRILXQWXLZSW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid?
The IUPAC name of 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid (CID 139523830) is 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid.
What is the SMILES notation for 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid?
The canonical SMILES for 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid is O=S(=O)(O)CC(F)(F)CCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid?
The InChIKey is VCYRILXQWXLZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2O3S/c15-14(16,9-20(17,18)19)2-1-13-6-10-3-11(7-13)5-12(4-10)8-13/h10-12H,1-9H2,(H,17,18,19).
What are the key properties of 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid?
4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid has a molecular weight of 308.39 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-2,2-difluorobutane-1-sulfonic acid is sourced from PubChem (CID 139523830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).