C33H39Cl2N5O2 — CID 139524093
tert-butyl N-[(1S)-2-[4-[5-(2,3-dichloropyridine-4-carboximidoyl)-6-methylpyrazin-2-yl]pent-4-enyl]-2-propyl-1,3-dihydroinden-1-yl]carbamate (PubChem CID 139524093) has the molecular formula C33H39Cl2N5O2 and a molecular weight of 608.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[4-[5-(2,3-dichloropyridine-4-carboximidoyl)-6-methylpyrazin-2-yl]pent-4-enyl]-2-propyl-1,3-dihydroinden-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[4-[5-(2,3-dichloropyridine-4-carboximidoyl)-6-methylpyrazin-2-yl]pent-4-enyl]-2-propyl-1,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 139524093 |
| Molecular Formula | C33H39Cl2N5O2 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | tert-butyl N-[(1S)-2-[4-[5-(2,3-dichloropyridine-4-carboximidoyl)-6-methylpyrazin-2-yl]pent-4-enyl]-2-propyl-1,3-dihydroinden-1-yl]carbamate |
| SMILES | [H]/N=C(\c1ccnc(Cl)c1Cl)c1ncc(C(=C)CCCC2(CCC)Cc3ccccc3[C@H]2NC(=O)OC(C)(C)C)nc1C |
| InChI | InChI=1S/C33H39Cl2N5O2/c1-7-15-33(18-22-12-8-9-13-23(22)29(33)40-31(41)42-32(4,5)6)16-10-11-20(2)25-19-38-28(21(3)39-25)27(36)24-14-17-37-30(35)26(24)34/h8-9,12-14,17,19,29,36H,2,7,10-11,15-16,18H2,1,3-6H3,(H,40,41)/b36-27+/t29-,33?/m1/s1 |
| InChIKey | BIRUFXKJFPNDAH-OEYMHFKWSA-N |
| XLogP | 8.70 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|