About (1S)-2,2-diethyl-1,3-dihydroinden-1-amine
(1S)-2,2-diethyl-1,3-dihydroinden-1-amine (PubChem CID 139524434) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (1S)-2,2-diethyl-1,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | (1S)-2,2-diethyl-1,3-dihydroinden-1-amine |
| PubChem CID | 139524434 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1S)-2,2-diethyl-1,3-dihydroinden-1-amine |
| SMILES | CCC1(CC)Cc2ccccc2[C@H]1N |
| InChI | InChI=1S/C13H19N/c1-3-13(4-2)9-10-7-5-6-8-11(10)12(13)14/h5-8,12H,3-4,9,14H2,1-2H3/t12-/m1/s1 |
| InChIKey | RWMWMPQYFGNFRB-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-2,2-diethyl-1,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-diethyl-1,3-dihydroinden-1-amine?
The IUPAC name of (1S)-2,2-diethyl-1,3-dihydroinden-1-amine (CID 139524434) is (1S)-2,2-diethyl-1,3-dihydroinden-1-amine.
What is the SMILES notation for (1S)-2,2-diethyl-1,3-dihydroinden-1-amine?
The canonical SMILES for (1S)-2,2-diethyl-1,3-dihydroinden-1-amine is CCC1(CC)Cc2ccccc2[C@H]1N.
What is the InChIKey of (1S)-2,2-diethyl-1,3-dihydroinden-1-amine?
The InChIKey is RWMWMPQYFGNFRB-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H19N/c1-3-13(4-2)9-10-7-5-6-8-11(10)12(13)14/h5-8,12H,3-4,9,14H2,1-2H3/t12-/m1/s1.
What are the key properties of (1S)-2,2-diethyl-1,3-dihydroinden-1-amine?
(1S)-2,2-diethyl-1,3-dihydroinden-1-amine has a molecular weight of 189.30 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-diethyl-1,3-dihydroinden-1-amine is sourced from PubChem (CID 139524434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).