C37H23N7 — CID 139524711
20-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-9,12,15,20-tetrazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 139524711) has the molecular formula C37H23N7 and a molecular weight of 565.64 g/mol. Its IUPAC name is 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-9,12,15,20-tetrazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-9,12,15,20-tetrazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 139524711 |
| Molecular Formula | C37H23N7 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenyl-9,12,15,20-tetrazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4cccnc4c4ncc5c(c6ccccc6n5-c5ccccc5)c43)n2)cc1 |
| InChI | InChI=1S/C37H23N7/c1-4-13-24(14-5-1)35-40-36(25-15-6-2-7-16-25)42-37(41-35)44-29-21-12-22-38-32(29)33-34(44)31-27-19-10-11-20-28(27)43(30(31)23-39-33)26-17-8-3-9-18-26/h1-23H |
| InChIKey | NUAYOPICPAWNLU-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |