About 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine
8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine (PubChem CID 139524867) has the molecular formula C13H11BrN2
and a molecular weight of 275.15 g/mol. Its IUPAC name is 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine.
Molecular Properties
| Compound Name | 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine |
| PubChem CID | 139524867 |
| Molecular Formula | C13H11BrN2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine |
| SMILES | CC1(C)c2ccc(Br)cc2-c2ncncc21 |
| InChI | InChI=1S/C13H11BrN2/c1-13(2)10-4-3-8(14)5-9(10)12-11(13)6-15-7-16-12/h3-7H,1-2H3 |
| InChIKey | FNGTXNPJLWRQSR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine?
The IUPAC name of 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine (CID 139524867) is 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine.
What is the SMILES notation for 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine?
The canonical SMILES for 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine is CC1(C)c2ccc(Br)cc2-c2ncncc21.
What is the InChIKey of 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine?
The InChIKey is FNGTXNPJLWRQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2/c1-13(2)10-4-3-8(14)5-9(10)12-11(13)6-15-7-16-12/h3-7H,1-2H3.
What are the key properties of 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine?
8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine has a molecular weight of 275.15 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5,5-dimethylindeno[1,2-d]pyrimidine is sourced from PubChem (CID 139524867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).