C11H23NO5S — CID 139524998
[(3S)-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methyl methanesulfonate (PubChem CID 139524998) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is [(3S)-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methyl methanesulfonate.
| Compound Name | [(3S)-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 139524998 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(3S)-1-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]pyrrolidin-3-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)OC(O)N1CC[C@H](COS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H23NO5S/c1-11(2,3)17-10(13)12-6-5-9(7-12)8-16-18(4,14)15/h9-10,13H,5-8H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | OVWLXRRONGNUNS-RGURZIINSA-N |
| XLogP | 0.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|