C9H18N2 — CID 139525401
2,4-dimethyl-3,4,4a,5,6,7-hexahydro-1H-pyrrolo[1,2-c]pyrimidine (PubChem CID 139525401) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,4-dimethyl-3,4,4a,5,6,7-hexahydro-1H-pyrrolo[1,2-c]pyrimidine.
| Compound Name | 2,4-dimethyl-3,4,4a,5,6,7-hexahydro-1H-pyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 139525401 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,4-dimethyl-3,4,4a,5,6,7-hexahydro-1H-pyrrolo[1,2-c]pyrimidine |
| SMILES | CC1CN(C)CN2CCCC12 |
| InChI | InChI=1S/C9H18N2/c1-8-6-10(2)7-11-5-3-4-9(8)11/h8-9H,3-7H2,1-2H3 |
| InChIKey | BDBVQSNFILWDKP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |