About [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate
[2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate (PubChem CID 139525423) has the molecular formula C19H31F3O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate |
| PubChem CID | 139525423 |
| Molecular Formula | C19H31F3O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CC1CCC(CCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H31F3O3/c1-14(2)18(24)25-13-17(12-23)11-16-8-6-15(7-9-16)5-3-4-10-19(20,21)22/h15-17,23H,1,3-13H2,2H3 |
| InChIKey | HXGHRQGPIWPSTA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate?
The IUPAC name of [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate (CID 139525423) is [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate.
What is the SMILES notation for [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate?
The canonical SMILES for [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCC(CO)CC1CCC(CCCCC(F)(F)F)CC1.
What is the InChIKey of [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate?
The InChIKey is HXGHRQGPIWPSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31F3O3/c1-14(2)18(24)25-13-17(12-23)11-16-8-6-15(7-9-16)5-3-4-10-19(20,21)22/h15-17,23H,1,3-13H2,2H3.
What are the key properties of [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate?
[2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate has a molecular weight of 364.45 g/mol, XLogP of 5.03, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-[4-(5,5,5-trifluoropentyl)cyclohexyl]propyl] 2-methylprop-2-enoate is sourced from PubChem (CID 139525423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).