C33H39N3 — CID 139525755
6-cyclohexa-1,3-dien-1-yl-4,5-di(cyclohexa-2,4-dien-1-yl)-2-[4-(1,2,3,6-tetrahydropyridin-5-yl)cyclohex-2-en-1-yl]-1,4-dihydropyrimidine (PubChem CID 139525755) has the molecular formula C33H39N3 and a molecular weight of 477.70 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-4,5-di(cyclohexa-2,4-dien-1-yl)-2-[4-(1,2,3,6-tetrahydropyridin-5-yl)cyclohex-2-en-1-yl]-1,4-dihydropyrimidine.
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-4,5-di(cyclohexa-2,4-dien-1-yl)-2-[4-(1,2,3,6-tetrahydropyridin-5-yl)cyclohex-2-en-1-yl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 139525755 |
| Molecular Formula | C33H39N3 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-4,5-di(cyclohexa-2,4-dien-1-yl)-2-[4-(1,2,3,6-tetrahydropyridin-5-yl)cyclohex-2-en-1-yl]-1,4-dihydropyrimidine |
| SMILES | C1=CCCC(C2=C(C3C=CC=CC3)C(C3C=CC=CC3)N=C(C3C=CC(C4=CCCNC4)CC3)N2)=C1 |
| InChI | InChI=1S/C33H39N3/c1-4-11-25(12-5-1)30-31(26-13-6-2-7-14-26)35-33(36-32(30)27-15-8-3-9-16-27)28-20-18-24(19-21-28)29-17-10-22-34-23-29/h1-8,11,13,15,17-18,20,24-26,28,31,34H,9-10,12,14,16,19,21-23H2,(H,35,36) |
| InChIKey | WVGPMXNZKBJBJL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|