C11H24N2O — CID 139525993
2-methylpropyl N,N'-dipropylcarbamimidate (PubChem CID 139525993) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-methylpropyl N,N'-dipropylcarbamimidate.
| Compound Name | 2-methylpropyl N,N'-dipropylcarbamimidate |
|---|---|
| PubChem CID | 139525993 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-methylpropyl N,N'-dipropylcarbamimidate |
| SMILES | CCC/N=C(/NCCC)OCC(C)C |
| InChI | InChI=1S/C11H24N2O/c1-5-7-12-11(13-8-6-2)14-9-10(3)4/h10H,5-9H2,1-4H3,(H,12,13) |
| InChIKey | LGUSCYIIIYAURV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|