C20H25Cl2NO3 — CID 139526268
2-chloro-1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)ethanone (PubChem CID 139526268) has the molecular formula C20H25Cl2NO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-chloro-1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)ethanone.
| Compound Name | 2-chloro-1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)ethanone |
|---|---|
| PubChem CID | 139526268 |
| Molecular Formula | C20H25Cl2NO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-chloro-1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)ethanone |
| SMILES | CC1(C)Oc2ccc(Cl)cc2C2OCC3(CCN(C(=O)CCl)CC3)CC21 |
| InChI | InChI=1S/C20H25Cl2NO3/c1-19(2)15-10-20(5-7-23(8-6-20)17(24)11-21)12-25-18(15)14-9-13(22)3-4-16(14)26-19/h3-4,9,15,18H,5-8,10-12H2,1-2H3 |
| InChIKey | IZSRWDPPEFDFOH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|