C8H10INS — CID 139526477
7-iodo-3,4,4a,8a-tetrahydro-2H-1,3-benzothiazine (PubChem CID 139526477) has the molecular formula C8H10INS and a molecular weight of 279.15 g/mol. Its IUPAC name is 7-iodo-3,4,4a,8a-tetrahydro-2H-1,3-benzothiazine.
| Compound Name | 7-iodo-3,4,4a,8a-tetrahydro-2H-1,3-benzothiazine |
|---|---|
| PubChem CID | 139526477 |
| Molecular Formula | C8H10INS |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 7-iodo-3,4,4a,8a-tetrahydro-2H-1,3-benzothiazine |
| SMILES | IC1=CC2SCNCC2C=C1 |
| InChI | InChI=1S/C8H10INS/c9-7-2-1-6-4-10-5-11-8(6)3-7/h1-3,6,8,10H,4-5H2 |
| InChIKey | QFTTXBJZQQCIGI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|