C21H20FN5O — CID 139526843
(4-ethynyl-3-fluorophenyl)-[4-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methanone (PubChem CID 139526843) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is (4-ethynyl-3-fluorophenyl)-[4-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methanone.
| Compound Name | (4-ethynyl-3-fluorophenyl)-[4-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 139526843 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (4-ethynyl-3-fluorophenyl)-[4-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methanone |
| SMILES | C#Cc1ccc(C(=O)N2CCC(N(C)c3ncnc4[nH]ccc34)CC2)cc1F |
| InChI | InChI=1S/C21H20FN5O/c1-3-14-4-5-15(12-18(14)22)21(28)27-10-7-16(8-11-27)26(2)20-17-6-9-23-19(17)24-13-25-20/h1,4-6,9,12-13,16H,7-8,10-11H2,2H3,(H,23,24,25) |
| InChIKey | VAMOZXACWBPGKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|