About N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide
N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 139527918) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 139527918 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)NC(=O)c1ncc(C(C)C)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-6(2)8-5-11-10(14-8)9(13)12-7(3)4/h5-7H,1-4H3,(H,12,13) |
| InChIKey | SGFPDDQNEJHEOL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide?
The IUPAC name of N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide (CID 139527918) is N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide is CC(C)NC(=O)c1ncc(C(C)C)s1.
What is the InChIKey of N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide?
The InChIKey is SGFPDDQNEJHEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-6(2)8-5-11-10(14-8)9(13)12-7(3)4/h5-7H,1-4H3,(H,12,13).
What are the key properties of N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide?
N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide has a molecular weight of 212.32 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-di(propan-2-yl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 139527918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).