C13H20N2O4 — CID 139528057
ethyl 2-[[(3Z,5E)-3-ethenyl-6-nitrohepta-3,5-dienyl]amino]acetate (PubChem CID 139528057) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 2-[[(3Z,5E)-3-ethenyl-6-nitrohepta-3,5-dienyl]amino]acetate.
| Compound Name | ethyl 2-[[(3Z,5E)-3-ethenyl-6-nitrohepta-3,5-dienyl]amino]acetate |
|---|---|
| PubChem CID | 139528057 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl 2-[[(3Z,5E)-3-ethenyl-6-nitrohepta-3,5-dienyl]amino]acetate |
| SMILES | C=C/C(=C\C=C(/C)[N+](=O)[O-])CCNCC(=O)OCC |
| InChI | InChI=1S/C13H20N2O4/c1-4-12(7-6-11(3)15(17)18)8-9-14-10-13(16)19-5-2/h4,6-7,14H,1,5,8-10H2,2-3H3/b11-6+,12-7+ |
| InChIKey | PAULXVGTNSOJRL-GNXRPPCSSA-N |
| XLogP | 1.82 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|